C10H23N3O4S — CID 106286779
ethyl N-[(2-amino-3-ethylpentyl)sulfamoyl]carbamate (PubChem CID 106286779) has the molecular formula C10H23N3O4S and a molecular weight of 281.38 g/mol. Its IUPAC name is ethyl N-[(2-amino-3-ethylpentyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-amino-3-ethylpentyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106286779 |
| Molecular Formula | C10H23N3O4S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl N-[(2-amino-3-ethylpentyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCC(N)C(CC)CC |
| InChI | InChI=1S/C10H23N3O4S/c1-4-8(5-2)9(11)7-12-18(15,16)13-10(14)17-6-3/h8-9,12H,4-7,11H2,1-3H3,(H,13,14) |
| InChIKey | VHMISAFDESJLSU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |