About ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate
ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate (PubChem CID 106184660) has the molecular formula C9H20N2O5S
and a molecular weight of 268.33 g/mol. Its IUPAC name is ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate.
Analyze ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate?
The IUPAC name of ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate (CID 106184660) is ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate.
What is the SMILES notation for ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate?
The canonical SMILES for ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate is CCOC(=O)NS(=O)(=O)NC(C)(C)C(C)(C)O.
What is the InChIKey of ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate?
The InChIKey is AFRWHGLHXKKMMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O5S/c1-6-16-7(12)10-17(14,15)11-8(2,3)9(4,5)13/h11,13H,6H2,1-5H3,(H,10,12).
What are the key properties of ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate?
ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate has a molecular weight of 268.33 g/mol, XLogP of 0.12, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3-hydroxy-2,3-dimethylbutan-2-yl)sulfamoyl]carbamate is sourced from PubChem (CID 106184660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).