C8H17N3O4S2 — CID 114463701
ethyl N-[(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)sulfamoyl]carbamate (PubChem CID 114463701) has the molecular formula C8H17N3O4S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is ethyl N-[(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463701 |
| Molecular Formula | C8H17N3O4S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl N-[(3-amino-2,2-dimethyl-3-sulfanylidenepropyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCC(C)(C)C(N)=S |
| InChI | InChI=1S/C8H17N3O4S2/c1-4-15-7(12)11-17(13,14)10-5-8(2,3)6(9)16/h10H,4-5H2,1-3H3,(H2,9,16)(H,11,12) |
| InChIKey | JABZLJWTSRWYPF-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|