C10H22N2O5S — CID 106253368
ethyl N-[[2-ethyl-2-(hydroxymethyl)butyl]sulfamoyl]carbamate (PubChem CID 106253368) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is ethyl N-[[2-ethyl-2-(hydroxymethyl)butyl]sulfamoyl]carbamate.
| Compound Name | ethyl N-[[2-ethyl-2-(hydroxymethyl)butyl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106253368 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | ethyl N-[[2-ethyl-2-(hydroxymethyl)butyl]sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCC(CC)(CC)CO |
| InChI | InChI=1S/C10H22N2O5S/c1-4-10(5-2,8-13)7-11-18(15,16)12-9(14)17-6-3/h11,13H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | JSISTSXIONILIW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |