C11H26N2O3S — CID 106253301
2-[(tert-butylsulfamoylamino)methyl]-2-ethylbutan-1-ol (PubChem CID 106253301) has the molecular formula C11H26N2O3S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-[(tert-butylsulfamoylamino)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(tert-butylsulfamoylamino)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 106253301 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-[(tert-butylsulfamoylamino)methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)CNS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H26N2O3S/c1-6-11(7-2,9-14)8-12-17(15,16)13-10(3,4)5/h12-14H,6-9H2,1-5H3 |
| InChIKey | OURYMJLBPFJXQY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |