C11H27N3O2S — CID 106251175
N'-(tert-butylsulfamoyl)-2,2-diethylpropane-1,3-diamine (PubChem CID 106251175) has the molecular formula C11H27N3O2S and a molecular weight of 265.42 g/mol. Its IUPAC name is N'-(tert-butylsulfamoyl)-2,2-diethylpropane-1,3-diamine.
| Compound Name | N'-(tert-butylsulfamoyl)-2,2-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 106251175 |
| Molecular Formula | C11H27N3O2S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N'-(tert-butylsulfamoyl)-2,2-diethylpropane-1,3-diamine |
| SMILES | CCC(CC)(CN)CNS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H27N3O2S/c1-6-11(7-2,8-12)9-13-17(15,16)14-10(3,4)5/h13-14H,6-9,12H2,1-5H3 |
| InChIKey | AELAWDJPBREZGV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |