C13H20ClNO3S — CID 103844707
4-chloro-N-[2-ethyl-2-(hydroxymethyl)butyl]benzenesulfonamide (PubChem CID 103844707) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 4-chloro-N-[2-ethyl-2-(hydroxymethyl)butyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-ethyl-2-(hydroxymethyl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103844707 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-chloro-N-[2-ethyl-2-(hydroxymethyl)butyl]benzenesulfonamide |
| SMILES | CCC(CC)(CO)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClNO3S/c1-3-13(4-2,10-16)9-15-19(17,18)12-7-5-11(14)6-8-12/h5-8,15-16H,3-4,9-10H2,1-2H3 |
| InChIKey | CPMAQMVFMGQROK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |