C23H32Cl2N2O4S2 — CID 98157755
4-chloro-N-[(4S)-4-[[(4-chlorophenyl)sulfonylamino]methyl]-4-ethyloctyl]benzenesulfonamide (PubChem CID 98157755) has the molecular formula C23H32Cl2N2O4S2 and a molecular weight of 535.56 g/mol. Its IUPAC name is 4-chloro-N-[(4S)-4-[[(4-chlorophenyl)sulfonylamino]methyl]-4-ethyloctyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4S)-4-[[(4-chlorophenyl)sulfonylamino]methyl]-4-ethyloctyl]benzenesulfonamide |
|---|---|
| PubChem CID | 98157755 |
| Molecular Formula | C23H32Cl2N2O4S2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 4-chloro-N-[(4S)-4-[[(4-chlorophenyl)sulfonylamino]methyl]-4-ethyloctyl]benzenesulfonamide |
| SMILES | CCCC[C@@](CC)(CCCNS(=O)(=O)c1ccc(Cl)cc1)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H32Cl2N2O4S2/c1-3-5-15-23(4-2,18-27-33(30,31)22-13-9-20(25)10-14-22)16-6-17-26-32(28,29)21-11-7-19(24)8-12-21/h7-14,26-27H,3-6,15-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | PXRUAOHWBYSXGS-QHCPKHFHSA-N |
| XLogP | 5.62 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|