C8H17N3O4S — CID 114464719
ethyl N-[2-(cyclopropylamino)ethylsulfamoyl]carbamate (PubChem CID 114464719) has the molecular formula C8H17N3O4S and a molecular weight of 251.31 g/mol. Its IUPAC name is ethyl N-[2-(cyclopropylamino)ethylsulfamoyl]carbamate.
| Compound Name | ethyl N-[2-(cyclopropylamino)ethylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464719 |
| Molecular Formula | C8H17N3O4S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | ethyl N-[2-(cyclopropylamino)ethylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCCNC1CC1 |
| InChI | InChI=1S/C8H17N3O4S/c1-2-15-8(12)11-16(13,14)10-6-5-9-7-3-4-7/h7,9-10H,2-6H2,1H3,(H,11,12) |
| InChIKey | DGSXOZRHQHSIJM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|