C10H21N3O4S — CID 114463242
ethyl N-(2-piperidin-3-ylethylsulfamoyl)carbamate (PubChem CID 114463242) has the molecular formula C10H21N3O4S and a molecular weight of 279.36 g/mol. Its IUPAC name is ethyl N-(2-piperidin-3-ylethylsulfamoyl)carbamate.
| Compound Name | ethyl N-(2-piperidin-3-ylethylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114463242 |
| Molecular Formula | C10H21N3O4S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | ethyl N-(2-piperidin-3-ylethylsulfamoyl)carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCCC1CCCNC1 |
| InChI | InChI=1S/C10H21N3O4S/c1-2-17-10(14)13-18(15,16)12-7-5-9-4-3-6-11-8-9/h9,11-12H,2-8H2,1H3,(H,13,14) |
| InChIKey | AEIZIQFGRZUTIN-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |