C10H20N4O5S — CID 114461853
ethyl N-[(2-amino-2-oxoethyl)-piperidin-3-ylsulfamoyl]carbamate (PubChem CID 114461853) has the molecular formula C10H20N4O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl N-[(2-amino-2-oxoethyl)-piperidin-3-ylsulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-amino-2-oxoethyl)-piperidin-3-ylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461853 |
| Molecular Formula | C10H20N4O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | ethyl N-[(2-amino-2-oxoethyl)-piperidin-3-ylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(CC(N)=O)C1CCCNC1 |
| InChI | InChI=1S/C10H20N4O5S/c1-2-19-10(16)13-20(17,18)14(7-9(11)15)8-4-3-5-12-6-8/h8,12H,2-7H2,1H3,(H2,11,15)(H,13,16) |
| InChIKey | HGCRVQGBTDCUAI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |