C9H17BrN2O4S — CID 102873518
ethyl N-[2-bromoethyl(cyclobutyl)sulfamoyl]carbamate (PubChem CID 102873518) has the molecular formula C9H17BrN2O4S and a molecular weight of 329.22 g/mol. Its IUPAC name is ethyl N-[2-bromoethyl(cyclobutyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[2-bromoethyl(cyclobutyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 102873518 |
| Molecular Formula | C9H17BrN2O4S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | ethyl N-[2-bromoethyl(cyclobutyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N(CCBr)C1CCC1 |
| InChI | InChI=1S/C9H17BrN2O4S/c1-2-16-9(13)11-17(14,15)12(7-6-10)8-4-3-5-8/h8H,2-7H2,1H3,(H,11,13) |
| InChIKey | DHNMWPQRMHXYBF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|