C8H18N4O3S — CID 114810545
2-[methylsulfamoyl(piperidin-4-yl)amino]acetamide (PubChem CID 114810545) has the molecular formula C8H18N4O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-[methylsulfamoyl(piperidin-4-yl)amino]acetamide.
| Compound Name | 2-[methylsulfamoyl(piperidin-4-yl)amino]acetamide |
|---|---|
| PubChem CID | 114810545 |
| Molecular Formula | C8H18N4O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-[methylsulfamoyl(piperidin-4-yl)amino]acetamide |
| SMILES | CNS(=O)(=O)N(CC(N)=O)C1CCNCC1 |
| InChI | InChI=1S/C8H18N4O3S/c1-10-16(14,15)12(6-8(9)13)7-2-4-11-5-3-7/h7,10-11H,2-6H2,1H3,(H2,9,13) |
| InChIKey | RECXWLUHBCRKHL-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |