C10H19N3O5S — CID 61360325
methyl 2-[(2-amino-2-oxoethyl)-piperidin-4-ylsulfamoyl]acetate (PubChem CID 61360325) has the molecular formula C10H19N3O5S and a molecular weight of 293.34 g/mol. Its IUPAC name is methyl 2-[(2-amino-2-oxoethyl)-piperidin-4-ylsulfamoyl]acetate.
| Compound Name | methyl 2-[(2-amino-2-oxoethyl)-piperidin-4-ylsulfamoyl]acetate |
|---|---|
| PubChem CID | 61360325 |
| Molecular Formula | C10H19N3O5S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | methyl 2-[(2-amino-2-oxoethyl)-piperidin-4-ylsulfamoyl]acetate |
| SMILES | COC(=O)CS(=O)(=O)N(CC(N)=O)C1CCNCC1 |
| InChI | InChI=1S/C10H19N3O5S/c1-18-10(15)7-19(16,17)13(6-9(11)14)8-2-4-12-5-3-8/h8,12H,2-7H2,1H3,(H2,11,14) |
| InChIKey | NQPLFFSBWAXTQF-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |