C13H18ClN3O3S — CID 60801411
2-[(3-chlorophenyl)sulfonyl-piperidin-4-ylamino]acetamide (PubChem CID 60801411) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.82 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)sulfonyl-piperidin-4-ylamino]acetamide.
| Compound Name | 2-[(3-chlorophenyl)sulfonyl-piperidin-4-ylamino]acetamide |
|---|---|
| PubChem CID | 60801411 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2-[(3-chlorophenyl)sulfonyl-piperidin-4-ylamino]acetamide |
| SMILES | NC(=O)CN(C1CCNCC1)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O3S/c14-10-2-1-3-12(8-10)21(19,20)17(9-13(15)18)11-4-6-16-7-5-11/h1-3,8,11,16H,4-7,9H2,(H2,15,18) |
| InChIKey | PQDZJUJIQDRVHO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |