C14H16ClN3O3S — CID 60539815
2-[(3-chloro-4-cyanophenyl)sulfonyl-cyclopentylamino]acetamide (PubChem CID 60539815) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is 2-[(3-chloro-4-cyanophenyl)sulfonyl-cyclopentylamino]acetamide.
| Compound Name | 2-[(3-chloro-4-cyanophenyl)sulfonyl-cyclopentylamino]acetamide |
|---|---|
| PubChem CID | 60539815 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[(3-chloro-4-cyanophenyl)sulfonyl-cyclopentylamino]acetamide |
| SMILES | N#Cc1ccc(S(=O)(=O)N(CC(N)=O)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C14H16ClN3O3S/c15-13-7-12(6-5-10(13)8-16)22(20,21)18(9-14(17)19)11-3-1-2-4-11/h5-7,11H,1-4,9H2,(H2,17,19) |
| InChIKey | QREKFXSUWQXPGN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |