C11H21BrN2O4S — CID 114466708
ethyl N-[[2-(bromomethyl)cyclohexyl]methylsulfamoyl]carbamate (PubChem CID 114466708) has the molecular formula C11H21BrN2O4S and a molecular weight of 357.27 g/mol. Its IUPAC name is ethyl N-[[2-(bromomethyl)cyclohexyl]methylsulfamoyl]carbamate.
| Compound Name | ethyl N-[[2-(bromomethyl)cyclohexyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466708 |
| Molecular Formula | C11H21BrN2O4S |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | ethyl N-[[2-(bromomethyl)cyclohexyl]methylsulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCC1CCCCC1CBr |
| InChI | InChI=1S/C11H21BrN2O4S/c1-2-18-11(15)14-19(16,17)13-8-10-6-4-3-5-9(10)7-12/h9-10,13H,2-8H2,1H3,(H,14,15) |
| InChIKey | TUUZDNAXMSBXGA-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|