C12H24N2O5S — CID 114464267
propan-2-yl N-[[2-(hydroxymethyl)cyclohexyl]methylsulfamoyl]carbamate (PubChem CID 114464267) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is propan-2-yl N-[[2-(hydroxymethyl)cyclohexyl]methylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[[2-(hydroxymethyl)cyclohexyl]methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464267 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | propan-2-yl N-[[2-(hydroxymethyl)cyclohexyl]methylsulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCC1CCCCC1CO |
| InChI | InChI=1S/C12H24N2O5S/c1-9(2)19-12(16)14-20(17,18)13-7-10-5-3-4-6-11(10)8-15/h9-11,13,15H,3-8H2,1-2H3,(H,14,16) |
| InChIKey | DEARHDGYBPNKMQ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |