C10H20N2O5S — CID 114464241
propan-2-yl N-[(1-hydroxycyclopentyl)methylsulfamoyl]carbamate (PubChem CID 114464241) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is propan-2-yl N-[(1-hydroxycyclopentyl)methylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(1-hydroxycyclopentyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464241 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | propan-2-yl N-[(1-hydroxycyclopentyl)methylsulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NCC1(O)CCCC1 |
| InChI | InChI=1S/C10H20N2O5S/c1-8(2)17-9(13)12-18(15,16)11-7-10(14)5-3-4-6-10/h8,11,14H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | GUYGSXYWGUVWEV-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |