C13H26N2O5S — CID 114464254
propan-2-yl N-[(4-ethyl-1-hydroxycyclohexyl)methylsulfamoyl]carbamate (PubChem CID 114464254) has the molecular formula C13H26N2O5S and a molecular weight of 322.43 g/mol. Its IUPAC name is propan-2-yl N-[(4-ethyl-1-hydroxycyclohexyl)methylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(4-ethyl-1-hydroxycyclohexyl)methylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464254 |
| Molecular Formula | C13H26N2O5S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | propan-2-yl N-[(4-ethyl-1-hydroxycyclohexyl)methylsulfamoyl]carbamate |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)NC(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O5S/c1-4-11-5-7-13(17,8-6-11)9-14-21(18,19)15-12(16)20-10(2)3/h10-11,14,17H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | QMYBZEBBKQOOBH-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |