C13H27NO3S — CID 65121362
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-1-sulfonamide (PubChem CID 65121362) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-1-sulfonamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 65121362 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-1-sulfonamide |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)CC(C)C)CC1 |
| InChI | InChI=1S/C13H27NO3S/c1-4-12-5-7-13(15,8-6-12)10-14-18(16,17)9-11(2)3/h11-12,14-15H,4-10H2,1-3H3 |
| InChIKey | GGUYPMHKLINADP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |