C13H28N2O3S — CID 114809575
1-[(tert-butylsulfamoylamino)methyl]-4-ethylcyclohexan-1-ol (PubChem CID 114809575) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is 1-[(tert-butylsulfamoylamino)methyl]-4-ethylcyclohexan-1-ol.
| Compound Name | 1-[(tert-butylsulfamoylamino)methyl]-4-ethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 114809575 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-[(tert-butylsulfamoylamino)methyl]-4-ethylcyclohexan-1-ol |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)NC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H28N2O3S/c1-5-11-6-8-13(16,9-7-11)10-14-19(17,18)15-12(2,3)4/h11,14-16H,5-10H2,1-4H3 |
| InChIKey | VBLYBBLGFSHIQF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |