C14H29NO4S — CID 79594392
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-propan-2-yloxyethanesulfonamide (PubChem CID 79594392) has the molecular formula C14H29NO4S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-propan-2-yloxyethanesulfonamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-propan-2-yloxyethanesulfonamide |
|---|---|
| PubChem CID | 79594392 |
| Molecular Formula | C14H29NO4S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-propan-2-yloxyethanesulfonamide |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)CCOC(C)C)CC1 |
| InChI | InChI=1S/C14H29NO4S/c1-4-13-5-7-14(16,8-6-13)11-15-20(17,18)10-9-19-12(2)3/h12-13,15-16H,4-11H2,1-3H3 |
| InChIKey | BMXSQABNAIGXGI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |