C13H27NO3S — CID 65121313
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-2-sulfonamide (PubChem CID 65121313) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 65121313 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-2-methylpropane-2-sulfonamide |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H27NO3S/c1-5-11-6-8-13(15,9-7-11)10-14-18(16,17)12(2,3)4/h11,14-15H,5-10H2,1-4H3 |
| InChIKey | JEFCBBZLHAZFAR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |