C14H29NO3S — CID 65121314
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-3-methylbutane-1-sulfonamide (PubChem CID 65121314) has the molecular formula C14H29NO3S and a molecular weight of 291.46 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-3-methylbutane-1-sulfonamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65121314 |
| Molecular Formula | C14H29NO3S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-3-methylbutane-1-sulfonamide |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)CCC(C)C)CC1 |
| InChI | InChI=1S/C14H29NO3S/c1-4-13-5-8-14(16,9-6-13)11-15-19(17,18)10-7-12(2)3/h12-13,15-16H,4-11H2,1-3H3 |
| InChIKey | DKLAJJZZWGUHOZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |