C13H23N3O3S — CID 65121845
N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide (PubChem CID 65121845) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 65121845 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[(4-ethyl-1-hydroxycyclohexyl)methyl]-5-methyl-1H-pyrazole-4-sulfonamide |
| SMILES | CCC1CCC(O)(CNS(=O)(=O)c2cn[nH]c2C)CC1 |
| InChI | InChI=1S/C13H23N3O3S/c1-3-11-4-6-13(17,7-5-11)9-15-20(18,19)12-8-14-16-10(12)2/h8,11,15,17H,3-7,9H2,1-2H3,(H,14,16) |
| InChIKey | DENHDWSFMNPPNM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |