C13H23N3O4S — CID 114463344
propan-2-yl N-[(1-cyano-4-ethylcyclohexyl)sulfamoyl]carbamate (PubChem CID 114463344) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is propan-2-yl N-[(1-cyano-4-ethylcyclohexyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(1-cyano-4-ethylcyclohexyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463344 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | propan-2-yl N-[(1-cyano-4-ethylcyclohexyl)sulfamoyl]carbamate |
| SMILES | CCC1CCC(C#N)(NS(=O)(=O)NC(=O)OC(C)C)CC1 |
| InChI | InChI=1S/C13H23N3O4S/c1-4-11-5-7-13(9-14,8-6-11)16-21(18,19)15-12(17)20-10(2)3/h10-11,16H,4-8H2,1-3H3,(H,15,17) |
| InChIKey | JPHIFYWPKPPDID-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |