C10H19ClN2O5S — CID 106301452
propan-2-yl N-[[4-(chloromethyl)oxan-4-yl]sulfamoyl]carbamate (PubChem CID 106301452) has the molecular formula C10H19ClN2O5S and a molecular weight of 314.79 g/mol. Its IUPAC name is propan-2-yl N-[[4-(chloromethyl)oxan-4-yl]sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[[4-(chloromethyl)oxan-4-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106301452 |
| Molecular Formula | C10H19ClN2O5S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | propan-2-yl N-[[4-(chloromethyl)oxan-4-yl]sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NC1(CCl)CCOCC1 |
| InChI | InChI=1S/C10H19ClN2O5S/c1-8(2)18-9(14)12-19(15,16)13-10(7-11)3-5-17-6-4-10/h8,13H,3-7H2,1-2H3,(H,12,14) |
| InChIKey | MQRYZLGDQATVDW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|