C8H17ClN2O4S — CID 114466308
propan-2-yl N-(1-chlorobutan-2-ylsulfamoyl)carbamate (PubChem CID 114466308) has the molecular formula C8H17ClN2O4S and a molecular weight of 272.75 g/mol. Its IUPAC name is propan-2-yl N-(1-chlorobutan-2-ylsulfamoyl)carbamate.
| Compound Name | propan-2-yl N-(1-chlorobutan-2-ylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114466308 |
| Molecular Formula | C8H17ClN2O4S |
| Molecular Weight | 272.75 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | propan-2-yl N-(1-chlorobutan-2-ylsulfamoyl)carbamate |
| SMILES | CCC(CCl)NS(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C8H17ClN2O4S/c1-4-7(5-9)10-16(13,14)11-8(12)15-6(2)3/h6-7,10H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | MZMNLYPIKZCLLF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.75 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|