C8H18N2O4S — CID 114463084
propan-2-yl N-(butan-2-ylsulfamoyl)carbamate (PubChem CID 114463084) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is propan-2-yl N-(butan-2-ylsulfamoyl)carbamate.
| Compound Name | propan-2-yl N-(butan-2-ylsulfamoyl)carbamate |
|---|---|
| PubChem CID | 114463084 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | propan-2-yl N-(butan-2-ylsulfamoyl)carbamate |
| SMILES | CCC(C)NS(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C8H18N2O4S/c1-5-7(4)9-15(12,13)10-8(11)14-6(2)3/h6-7,9H,5H2,1-4H3,(H,10,11) |
| InChIKey | YSCDLWCAOFQHBD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |