C9H18N2O6S — CID 114462771
2-[(propan-2-yloxycarbonylsulfamoylamino)methyl]butanoic acid (PubChem CID 114462771) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[(propan-2-yloxycarbonylsulfamoylamino)methyl]butanoic acid.
| Compound Name | 2-[(propan-2-yloxycarbonylsulfamoylamino)methyl]butanoic acid |
|---|---|
| PubChem CID | 114462771 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-[(propan-2-yloxycarbonylsulfamoylamino)methyl]butanoic acid |
| SMILES | CCC(CNS(=O)(=O)NC(=O)OC(C)C)C(=O)O |
| InChI | InChI=1S/C9H18N2O6S/c1-4-7(8(12)13)5-10-18(15,16)11-9(14)17-6(2)3/h6-7,10H,4-5H2,1-3H3,(H,11,14)(H,12,13) |
| InChIKey | QLXNTCSGZHMRNZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |