C6H14N2O5S — CID 114463121
propan-2-yl N-(ethoxysulfamoyl)carbamate (PubChem CID 114463121) has the molecular formula C6H14N2O5S and a molecular weight of 226.25 g/mol. Its IUPAC name is propan-2-yl N-(ethoxysulfamoyl)carbamate.
| Compound Name | propan-2-yl N-(ethoxysulfamoyl)carbamate |
|---|---|
| PubChem CID | 114463121 |
| Molecular Formula | C6H14N2O5S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | propan-2-yl N-(ethoxysulfamoyl)carbamate |
| SMILES | CCONS(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C6H14N2O5S/c1-4-12-8-14(10,11)7-6(9)13-5(2)3/h5,8H,4H2,1-3H3,(H,7,9) |
| InChIKey | BNSJDROSRGIMPE-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|