C6H13N3O6S — CID 114463139
propan-2-yl N-[(2-amino-2-oxoethoxy)sulfamoyl]carbamate (PubChem CID 114463139) has the molecular formula C6H13N3O6S and a molecular weight of 255.25 g/mol. Its IUPAC name is propan-2-yl N-[(2-amino-2-oxoethoxy)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(2-amino-2-oxoethoxy)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463139 |
| Molecular Formula | C6H13N3O6S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | propan-2-yl N-[(2-amino-2-oxoethoxy)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)NOCC(N)=O |
| InChI | InChI=1S/C6H13N3O6S/c1-4(2)15-6(11)8-16(12,13)9-14-3-5(7)10/h4,9H,3H2,1-2H3,(H2,7,10)(H,8,11) |
| InChIKey | RTFNAYXEBKUBJB-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|