C9H20N2O5S2 — CID 106157379
propan-2-yl N-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]carbamate (PubChem CID 106157379) has the molecular formula C9H20N2O5S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is propan-2-yl N-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106157379 |
| Molecular Formula | C9H20N2O5S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | propan-2-yl N-[(4-hydroxy-3-methylsulfanylbutan-2-yl)sulfamoyl]carbamate |
| SMILES | CSC(CO)C(C)NS(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C9H20N2O5S2/c1-6(2)16-9(13)11-18(14,15)10-7(3)8(5-12)17-4/h6-8,10,12H,5H2,1-4H3,(H,11,13) |
| InChIKey | VSDCLUVHYPSBMO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |