C8H18N2O5S — CID 114464359
propan-2-yl N-[1-hydroxypropan-2-yl(methyl)sulfamoyl]carbamate (PubChem CID 114464359) has the molecular formula C8H18N2O5S and a molecular weight of 254.31 g/mol. Its IUPAC name is propan-2-yl N-[1-hydroxypropan-2-yl(methyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[1-hydroxypropan-2-yl(methyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464359 |
| Molecular Formula | C8H18N2O5S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | propan-2-yl N-[1-hydroxypropan-2-yl(methyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(C)C(C)CO |
| InChI | InChI=1S/C8H18N2O5S/c1-6(2)15-8(12)9-16(13,14)10(4)7(3)5-11/h6-7,11H,5H2,1-4H3,(H,9,12) |
| InChIKey | KCPNAGGVSTZILV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |