C9H17N3O4S — CID 114463424
propan-2-yl N-[1-cyanopropan-2-yl(methyl)sulfamoyl]carbamate (PubChem CID 114463424) has the molecular formula C9H17N3O4S and a molecular weight of 263.32 g/mol. Its IUPAC name is propan-2-yl N-[1-cyanopropan-2-yl(methyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[1-cyanopropan-2-yl(methyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463424 |
| Molecular Formula | C9H17N3O4S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | propan-2-yl N-[1-cyanopropan-2-yl(methyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(C)C(C)CC#N |
| InChI | InChI=1S/C9H17N3O4S/c1-7(2)16-9(13)11-17(14,15)12(4)8(3)5-6-10/h7-8H,5H2,1-4H3,(H,11,13) |
| InChIKey | IGGQZLAEXDAJMJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |