C7H15BrN2O4S — CID 114466545
propan-2-yl N-[2-bromoethyl(methyl)sulfamoyl]carbamate (PubChem CID 114466545) has the molecular formula C7H15BrN2O4S and a molecular weight of 303.18 g/mol. Its IUPAC name is propan-2-yl N-[2-bromoethyl(methyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[2-bromoethyl(methyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466545 |
| Molecular Formula | C7H15BrN2O4S |
| Molecular Weight | 303.18 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | propan-2-yl N-[2-bromoethyl(methyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(C)CCBr |
| InChI | InChI=1S/C7H15BrN2O4S/c1-6(2)14-7(11)9-15(12,13)10(3)5-4-8/h6H,4-5H2,1-3H3,(H,9,11) |
| InChIKey | AOBJWPMSKURPCS-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|