C10H21BrN2O4S — CID 114466588
propan-2-yl N-[3-bromopropyl(propan-2-yl)sulfamoyl]carbamate (PubChem CID 114466588) has the molecular formula C10H21BrN2O4S and a molecular weight of 345.26 g/mol. Its IUPAC name is propan-2-yl N-[3-bromopropyl(propan-2-yl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[3-bromopropyl(propan-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114466588 |
| Molecular Formula | C10H21BrN2O4S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | propan-2-yl N-[3-bromopropyl(propan-2-yl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(CCCBr)C(C)C |
| InChI | InChI=1S/C10H21BrN2O4S/c1-8(2)13(7-5-6-11)18(15,16)12-10(14)17-9(3)4/h8-9H,5-7H2,1-4H3,(H,12,14) |
| InChIKey | HXPNPUQQTMSGHJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|