C9H20N4O4S — CID 114467537
propan-2-yl N-[(2-amino-2-iminoethyl)-propan-2-ylsulfamoyl]carbamate (PubChem CID 114467537) has the molecular formula C9H20N4O4S and a molecular weight of 280.35 g/mol. Its IUPAC name is propan-2-yl N-[(2-amino-2-iminoethyl)-propan-2-ylsulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[(2-amino-2-iminoethyl)-propan-2-ylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114467537 |
| Molecular Formula | C9H20N4O4S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | propan-2-yl N-[(2-amino-2-iminoethyl)-propan-2-ylsulfamoyl]carbamate |
| SMILES | [H]/N=C(\N)CN(C(C)C)S(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C9H20N4O4S/c1-6(2)13(5-8(10)11)18(15,16)12-9(14)17-7(3)4/h6-7H,5H2,1-4H3,(H3,10,11)(H,12,14) |
| InChIKey | DRUPWQRLQUFQJL-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|