C7H15N3O4S2 — CID 114463668
methyl N-[(2-amino-2-sulfanylideneethyl)-propan-2-ylsulfamoyl]carbamate (PubChem CID 114463668) has the molecular formula C7H15N3O4S2 and a molecular weight of 269.35 g/mol. Its IUPAC name is methyl N-[(2-amino-2-sulfanylideneethyl)-propan-2-ylsulfamoyl]carbamate.
| Compound Name | methyl N-[(2-amino-2-sulfanylideneethyl)-propan-2-ylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463668 |
| Molecular Formula | C7H15N3O4S2 |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | methyl N-[(2-amino-2-sulfanylideneethyl)-propan-2-ylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N(CC(N)=S)C(C)C |
| InChI | InChI=1S/C7H15N3O4S2/c1-5(2)10(4-6(8)15)16(12,13)9-7(11)14-3/h5H,4H2,1-3H3,(H2,8,15)(H,9,11) |
| InChIKey | HLEZULSPDKYEFH-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|