C11H15N3O4S2 — CID 114463509
methyl N-[(3-amino-3-sulfanylidenepropyl)-phenylsulfamoyl]carbamate (PubChem CID 114463509) has the molecular formula C11H15N3O4S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl N-[(3-amino-3-sulfanylidenepropyl)-phenylsulfamoyl]carbamate.
| Compound Name | methyl N-[(3-amino-3-sulfanylidenepropyl)-phenylsulfamoyl]carbamate |
|---|---|
| PubChem CID | 114463509 |
| Molecular Formula | C11H15N3O4S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | methyl N-[(3-amino-3-sulfanylidenepropyl)-phenylsulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N(CCC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C11H15N3O4S2/c1-18-11(15)13-20(16,17)14(8-7-10(12)19)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H2,12,19)(H,13,15) |
| InChIKey | KHGGJSYOGXWMLG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|