C10H15N3O5S — CID 114461612
methyl N-[(2-aminophenyl)-(2-hydroxyethyl)sulfamoyl]carbamate (PubChem CID 114461612) has the molecular formula C10H15N3O5S and a molecular weight of 289.31 g/mol. Its IUPAC name is methyl N-[(2-aminophenyl)-(2-hydroxyethyl)sulfamoyl]carbamate.
| Compound Name | methyl N-[(2-aminophenyl)-(2-hydroxyethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114461612 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | methyl N-[(2-aminophenyl)-(2-hydroxyethyl)sulfamoyl]carbamate |
| SMILES | COC(=O)NS(=O)(=O)N(CCO)c1ccccc1N |
| InChI | InChI=1S/C10H15N3O5S/c1-18-10(15)12-19(16,17)13(6-7-14)9-5-3-2-4-8(9)11/h2-5,14H,6-7,11H2,1H3,(H,12,15) |
| InChIKey | BDWBFFVRHUDVEC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|