C7H16N2O5S — CID 114464122
propan-2-yl N-[2-hydroxyethyl(methyl)sulfamoyl]carbamate (PubChem CID 114464122) has the molecular formula C7H16N2O5S and a molecular weight of 240.28 g/mol. Its IUPAC name is propan-2-yl N-[2-hydroxyethyl(methyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[2-hydroxyethyl(methyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 114464122 |
| Molecular Formula | C7H16N2O5S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | propan-2-yl N-[2-hydroxyethyl(methyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(C)CCO |
| InChI | InChI=1S/C7H16N2O5S/c1-6(2)14-7(11)8-15(12,13)9(3)4-5-10/h6,10H,4-5H2,1-3H3,(H,8,11) |
| InChIKey | CWLCYRBMPXSQMR-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |