C8H14ClF3N2O4S — CID 107493090
propan-2-yl N-[2-chloroethyl(2,2,2-trifluoroethyl)sulfamoyl]carbamate (PubChem CID 107493090) has the molecular formula C8H14ClF3N2O4S and a molecular weight of 326.72 g/mol. Its IUPAC name is propan-2-yl N-[2-chloroethyl(2,2,2-trifluoroethyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[2-chloroethyl(2,2,2-trifluoroethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107493090 |
| Molecular Formula | C8H14ClF3N2O4S |
| Molecular Weight | 326.72 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | propan-2-yl N-[2-chloroethyl(2,2,2-trifluoroethyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(CCCl)CC(F)(F)F |
| InChI | InChI=1S/C8H14ClF3N2O4S/c1-6(2)18-7(15)13-19(16,17)14(4-3-9)5-8(10,11)12/h6H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | DEIVJUOIGIANEB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.72 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|