C9H18N2O6S — CID 114465476
methyl 3-[methyl(propan-2-yloxycarbonylsulfamoyl)amino]propanoate (PubChem CID 114465476) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 3-[methyl(propan-2-yloxycarbonylsulfamoyl)amino]propanoate.
| Compound Name | methyl 3-[methyl(propan-2-yloxycarbonylsulfamoyl)amino]propanoate |
|---|---|
| PubChem CID | 114465476 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | methyl 3-[methyl(propan-2-yloxycarbonylsulfamoyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NC(=O)OC(C)C |
| InChI | InChI=1S/C9H18N2O6S/c1-7(2)17-9(13)10-18(14,15)11(3)6-5-8(12)16-4/h7H,5-6H2,1-4H3,(H,10,13) |
| InChIKey | WKTBZLWVEKORMV-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |