C11H26ClN3O4S — CID 119983413
methyl 3-[(1-amino-4-methylpentan-2-yl)sulfamoyl-methylamino]propanoate;hydrochloride (PubChem CID 119983413) has the molecular formula C11H26ClN3O4S and a molecular weight of 331.87 g/mol. Its IUPAC name is methyl 3-[(1-amino-4-methylpentan-2-yl)sulfamoyl-methylamino]propanoate;hydrochloride.
| Compound Name | methyl 3-[(1-amino-4-methylpentan-2-yl)sulfamoyl-methylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119983413 |
| Molecular Formula | C11H26ClN3O4S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | methyl 3-[(1-amino-4-methylpentan-2-yl)sulfamoyl-methylamino]propanoate;hydrochloride |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NC(CN)CC(C)C.Cl |
| InChI | InChI=1S/C11H25N3O4S.ClH/c1-9(2)7-10(8-12)13-19(16,17)14(3)6-5-11(15)18-4;/h9-10,13H,5-8,12H2,1-4H3;1H |
| InChIKey | YYTPBYAGZRAMTM-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |