C9H20N2O5S — CID 106840462
methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate (PubChem CID 106840462) has the molecular formula C9H20N2O5S and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate.
| Compound Name | methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 106840462 |
| Molecular Formula | C9H20N2O5S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NCCCCO |
| InChI | InChI=1S/C9H20N2O5S/c1-11(7-5-9(13)16-2)17(14,15)10-6-3-4-8-12/h10,12H,3-8H2,1-2H3 |
| InChIKey | RKUKLKPNUHCUBB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|