methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate

C9H20N2O5S — CID 106840462

IUPACmethyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)S(=O)(=O)NCCCCO
InChIInChI=1S/C9H20N2O5S/c1-11(7-5-9(13)16-2)17(14,15)10-6-3-4-8-12/h10,12H,3-8H2,1-2H3
InChIKeyRKUKLKPNUHCUBB-UHFFFAOYSA-N
MW268.33 g/mol
LogP-0.91
Rot. Bonds9

About methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate

methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate (PubChem CID 106840462) has the molecular formula C9H20N2O5S and a molecular weight of 268.33 g/mol. Its IUPAC name is methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate
PubChem CID106840462
Molecular FormulaC9H20N2O5S
Molecular Weight268.33 g/mol
Exact Mass268.11
IUPAC Namemethyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)S(=O)(=O)NCCCCO
InChIInChI=1S/C9H20N2O5S/c1-11(7-5-9(13)16-2)17(14,15)10-6-3-4-8-12/h10,12H,3-8H2,1-2H3
InChIKeyRKUKLKPNUHCUBB-UHFFFAOYSA-N
XLogP-0.91
TPSA95.94 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds9
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.33
LogP ≤ 5-0.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate?
The IUPAC name of methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate (CID 106840462) is methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate.
What is the SMILES notation for methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate?
The canonical SMILES for methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate is COC(=O)CCN(C)S(=O)(=O)NCCCCO.
What is the InChIKey of methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate?
The InChIKey is RKUKLKPNUHCUBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O5S/c1-11(7-5-9(13)16-2)17(14,15)10-6-3-4-8-12/h10,12H,3-8H2,1-2H3.
What are the key properties of methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate?
methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate has a molecular weight of 268.33 g/mol, XLogP of -0.91, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-hydroxybutylsulfamoyl(methyl)amino]propanoate is sourced from PubChem (CID 106840462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).