C13H27N3O6S — CID 103731364
methyl 3-[methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]amino]propanoate (PubChem CID 103731364) has the molecular formula C13H27N3O6S and a molecular weight of 353.44 g/mol. Its IUPAC name is methyl 3-[methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]amino]propanoate.
| Compound Name | methyl 3-[methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]amino]propanoate |
|---|---|
| PubChem CID | 103731364 |
| Molecular Formula | C13H27N3O6S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | methyl 3-[methyl-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)S(=O)(=O)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27N3O6S/c1-13(2,3)22-12(18)14-8-6-9-15-23(19,20)16(4)10-7-11(17)21-5/h15H,6-10H2,1-5H3,(H,14,18) |
| InChIKey | WNMPWDRLFYJZDA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|