C11H22N2O6S — CID 114518054
3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]propanoic acid (PubChem CID 114518054) has the molecular formula C11H22N2O6S and a molecular weight of 310.37 g/mol. Its IUPAC name is 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]propanoic acid.
| Compound Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 114518054 |
| Molecular Formula | C11H22N2O6S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propylsulfamoyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCNS(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H22N2O6S/c1-11(2,3)19-10(16)12-6-4-7-13-20(17,18)8-5-9(14)15/h13H,4-8H2,1-3H3,(H,12,16)(H,14,15) |
| InChIKey | VFGIWERIBHZKLD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|