C13H32N4O6S2 — CID 157413343
N-(3-aminopropyl)methanesulfonamide;tert-butyl N-[3-(methanesulfonamido)propyl]carbamate (PubChem CID 157413343) has the molecular formula C13H32N4O6S2 and a molecular weight of 404.56 g/mol. Its IUPAC name is N-(3-aminopropyl)methanesulfonamide;tert-butyl N-[3-(methanesulfonamido)propyl]carbamate.
| Compound Name | N-(3-aminopropyl)methanesulfonamide;tert-butyl N-[3-(methanesulfonamido)propyl]carbamate |
|---|---|
| PubChem CID | 157413343 |
| Molecular Formula | C13H32N4O6S2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | N-(3-aminopropyl)methanesulfonamide;tert-butyl N-[3-(methanesulfonamido)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNS(C)(=O)=O.CS(=O)(=O)NCCCN |
| InChI | InChI=1S/C9H20N2O4S.C4H12N2O2S/c1-9(2,3)15-8(12)10-6-5-7-11-16(4,13)14;1-9(7,8)6-4-2-3-5/h11H,5-7H2,1-4H3,(H,10,12);6H,2-5H2,1H3 |
| InChIKey | BONYBPNTFRAZNI-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 156.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|